C13H20INO3S — CID 155374910
2,2,4-trimethyl-4-(3-methylsulfanyl-2,5-dioxopyrrolidin-1-yl)pentanoyl iodide (PubChem CID 155374910) has the molecular formula C13H20INO3S and a molecular weight of 397.28 g/mol. Its IUPAC name is 2,2,4-trimethyl-4-(3-methylsulfanyl-2,5-dioxopyrrolidin-1-yl)pentanoyl iodide.
| Compound Name | 2,2,4-trimethyl-4-(3-methylsulfanyl-2,5-dioxopyrrolidin-1-yl)pentanoyl iodide |
|---|---|
| PubChem CID | 155374910 |
| Molecular Formula | C13H20INO3S |
| Molecular Weight | 397.28 g/mol |
| Exact Mass | 397.02 |
| IUPAC Name | 2,2,4-trimethyl-4-(3-methylsulfanyl-2,5-dioxopyrrolidin-1-yl)pentanoyl iodide |
| SMILES | CSC1CC(=O)N(C(C)(C)CC(C)(C)C(=O)I)C1=O |
| InChI | InChI=1S/C13H20INO3S/c1-12(2,11(14)18)7-13(3,4)15-9(16)6-8(19-5)10(15)17/h8H,6-7H2,1-5H3 |
| InChIKey | LZFSQUCMWLDNEI-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.28 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|