C21H37N3O5S — CID 145402100
N-(5-amino-2,4,4-trimethyl-6-oxohexan-2-yl)-2-[3-(2,5-dioxo-3-sulfanylpyrrolidin-1-yl)-3-methylbutoxy]propanamide (PubChem CID 145402100) has the molecular formula C21H37N3O5S and a molecular weight of 443.61 g/mol. Its IUPAC name is N-(5-amino-2,4,4-trimethyl-6-oxohexan-2-yl)-2-[3-(2,5-dioxo-3-sulfanylpyrrolidin-1-yl)-3-methylbutoxy]propanamide.
| Compound Name | N-(5-amino-2,4,4-trimethyl-6-oxohexan-2-yl)-2-[3-(2,5-dioxo-3-sulfanylpyrrolidin-1-yl)-3-methylbutoxy]propanamide |
|---|---|
| PubChem CID | 145402100 |
| Molecular Formula | C21H37N3O5S |
| Molecular Weight | 443.61 g/mol |
| Exact Mass | 443.25 |
| IUPAC Name | N-(5-amino-2,4,4-trimethyl-6-oxohexan-2-yl)-2-[3-(2,5-dioxo-3-sulfanylpyrrolidin-1-yl)-3-methylbutoxy]propanamide |
| SMILES | CC(OCCC(C)(C)N1C(=O)CC(S)C1=O)C(=O)NC(C)(C)CC(C)(C)C(N)C=O |
| InChI | InChI=1S/C21H37N3O5S/c1-13(17(27)23-20(4,5)12-19(2,3)15(22)11-25)29-9-8-21(6,7)24-16(26)10-14(30)18(24)28/h11,13-15,30H,8-10,12,22H2,1-7H3,(H,23,27) |
| InChIKey | AQSPNFNICKWZPI-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 118.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.61 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|