C17H34N2O2 — CID 59105475
2,2,3,3-tetramethyl-N-[2-(2,2,3-trimethylbutanoylamino)ethyl]butanamide (PubChem CID 59105475) has the molecular formula C17H34N2O2 and a molecular weight of 298.47 g/mol. Its IUPAC name is 2,2,3,3-tetramethyl-N-[2-(2,2,3-trimethylbutanoylamino)ethyl]butanamide.
| Compound Name | 2,2,3,3-tetramethyl-N-[2-(2,2,3-trimethylbutanoylamino)ethyl]butanamide |
|---|---|
| PubChem CID | 59105475 |
| Molecular Formula | C17H34N2O2 |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.26 |
| IUPAC Name | 2,2,3,3-tetramethyl-N-[2-(2,2,3-trimethylbutanoylamino)ethyl]butanamide |
| SMILES | CC(C)C(C)(C)C(=O)NCCNC(=O)C(C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H34N2O2/c1-12(2)16(6,7)13(20)18-10-11-19-14(21)17(8,9)15(3,4)5/h12H,10-11H2,1-9H3,(H,18,20)(H,19,21) |
| InChIKey | NAZLXGKPCHTYGN-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|