C15H31NOS2 — CID 166996204
2,2,3-trimethyl-N-[2-methyl-2-(2-methylpropyldisulfanyl)propyl]butanamide (PubChem CID 166996204) has the molecular formula C15H31NOS2 and a molecular weight of 305.55 g/mol. Its IUPAC name is 2,2,3-trimethyl-N-[2-methyl-2-(2-methylpropyldisulfanyl)propyl]butanamide.
| Compound Name | 2,2,3-trimethyl-N-[2-methyl-2-(2-methylpropyldisulfanyl)propyl]butanamide |
|---|---|
| PubChem CID | 166996204 |
| Molecular Formula | C15H31NOS2 |
| Molecular Weight | 305.55 g/mol |
| Exact Mass | 305.18 |
| IUPAC Name | 2,2,3-trimethyl-N-[2-methyl-2-(2-methylpropyldisulfanyl)propyl]butanamide |
| SMILES | CC(C)CSSC(C)(C)CNC(=O)C(C)(C)C(C)C |
| InChI | InChI=1S/C15H31NOS2/c1-11(2)9-18-19-14(5,6)10-16-13(17)15(7,8)12(3)4/h11-12H,9-10H2,1-8H3,(H,16,17) |
| InChIKey | VFUVHDIRONSALW-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.55 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|