C14H18F3NO — CID 174866073
2,2,3-trimethyl-N-[(2,4,6-trifluorophenyl)methyl]butanamide (PubChem CID 174866073) has the molecular formula C14H18F3NO and a molecular weight of 273.30 g/mol. Its IUPAC name is 2,2,3-trimethyl-N-[(2,4,6-trifluorophenyl)methyl]butanamide.
| Compound Name | 2,2,3-trimethyl-N-[(2,4,6-trifluorophenyl)methyl]butanamide |
|---|---|
| PubChem CID | 174866073 |
| Molecular Formula | C14H18F3NO |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | 2,2,3-trimethyl-N-[(2,4,6-trifluorophenyl)methyl]butanamide |
| SMILES | CC(C)C(C)(C)C(=O)NCc1c(F)cc(F)cc1F |
| InChI | InChI=1S/C14H18F3NO/c1-8(2)14(3,4)13(19)18-7-10-11(16)5-9(15)6-12(10)17/h5-6,8H,7H2,1-4H3,(H,18,19) |
| InChIKey | RVWLSAAHFIYOMI-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |