C18H14F7NOS — CID 134106707
3-(2,5-difluorophenyl)sulfanyl-2,2-dimethyl-N-[(2,3,4,5,6-pentafluorophenyl)methyl]propanamide (PubChem CID 134106707) has the molecular formula C18H14F7NOS and a molecular weight of 425.37 g/mol. Its IUPAC name is 3-(2,5-difluorophenyl)sulfanyl-2,2-dimethyl-N-[(2,3,4,5,6-pentafluorophenyl)methyl]propanamide.
| Compound Name | 3-(2,5-difluorophenyl)sulfanyl-2,2-dimethyl-N-[(2,3,4,5,6-pentafluorophenyl)methyl]propanamide |
|---|---|
| PubChem CID | 134106707 |
| Molecular Formula | C18H14F7NOS |
| Molecular Weight | 425.37 g/mol |
| Exact Mass | 425.07 |
| IUPAC Name | 3-(2,5-difluorophenyl)sulfanyl-2,2-dimethyl-N-[(2,3,4,5,6-pentafluorophenyl)methyl]propanamide |
| SMILES | CC(C)(CSc1cc(F)ccc1F)C(=O)NCc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C18H14F7NOS/c1-18(2,7-28-11-5-8(19)3-4-10(11)20)17(27)26-6-9-12(21)14(23)16(25)15(24)13(9)22/h3-5H,6-7H2,1-2H3,(H,26,27) |
| InChIKey | CFUNMNFRLXZKBQ-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.37 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|