C20H31F2NO — CID 57218649
N-[(2,4-difluorophenyl)methyl]-2,2-dimethylundecanamide (PubChem CID 57218649) has the molecular formula C20H31F2NO and a molecular weight of 339.47 g/mol. Its IUPAC name is N-[(2,4-difluorophenyl)methyl]-2,2-dimethylundecanamide.
| Compound Name | N-[(2,4-difluorophenyl)methyl]-2,2-dimethylundecanamide |
|---|---|
| PubChem CID | 57218649 |
| Molecular Formula | C20H31F2NO |
| Molecular Weight | 339.47 g/mol |
| Exact Mass | 339.24 |
| IUPAC Name | N-[(2,4-difluorophenyl)methyl]-2,2-dimethylundecanamide |
| SMILES | CCCCCCCCCC(C)(C)C(=O)NCc1ccc(F)cc1F |
| InChI | InChI=1S/C20H31F2NO/c1-4-5-6-7-8-9-10-13-20(2,3)19(24)23-15-16-11-12-17(21)14-18(16)22/h11-12,14H,4-10,13,15H2,1-3H3,(H,23,24) |
| InChIKey | YNMXZGVLFQVNRH-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.47 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|