C12H14F2N2OS — CID 55053279
3-amino-N-[(2,4-difluorophenyl)methyl]-2,2-dimethyl-3-sulfanylidenepropanamide (PubChem CID 55053279) has the molecular formula C12H14F2N2OS and a molecular weight of 272.32 g/mol. Its IUPAC name is 3-amino-N-[(2,4-difluorophenyl)methyl]-2,2-dimethyl-3-sulfanylidenepropanamide.
| Compound Name | 3-amino-N-[(2,4-difluorophenyl)methyl]-2,2-dimethyl-3-sulfanylidenepropanamide |
|---|---|
| PubChem CID | 55053279 |
| Molecular Formula | C12H14F2N2OS |
| Molecular Weight | 272.32 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 3-amino-N-[(2,4-difluorophenyl)methyl]-2,2-dimethyl-3-sulfanylidenepropanamide |
| SMILES | CC(C)(C(=O)NCc1ccc(F)cc1F)C(N)=S |
| InChI | InChI=1S/C12H14F2N2OS/c1-12(2,10(15)18)11(17)16-6-7-3-4-8(13)5-9(7)14/h3-5H,6H2,1-2H3,(H2,15,18)(H,16,17) |
| InChIKey | RDHATQMZRLZQMU-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.32 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|