C8H9F2N3S — CID 51000201
1-amino-3-[(2,4-difluorophenyl)methyl]thiourea (PubChem CID 51000201) has the molecular formula C8H9F2N3S and a molecular weight of 217.24 g/mol. Its IUPAC name is 1-amino-3-[(2,4-difluorophenyl)methyl]thiourea.
| Compound Name | 1-amino-3-[(2,4-difluorophenyl)methyl]thiourea |
|---|---|
| PubChem CID | 51000201 |
| Molecular Formula | C8H9F2N3S |
| Molecular Weight | 217.24 g/mol |
| Exact Mass | 217.05 |
| IUPAC Name | 1-amino-3-[(2,4-difluorophenyl)methyl]thiourea |
| SMILES | NNC(=S)NCc1ccc(F)cc1F |
| InChI | InChI=1S/C8H9F2N3S/c9-6-2-1-5(7(10)3-6)4-12-8(14)13-11/h1-3H,4,11H2,(H2,12,13,14) |
| InChIKey | IZZMRTGCNKIVLR-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.24 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|