C18H26ClF2NO — CID 91233832
2-chloro-N-[(2,4-difluorophenyl)methyl]undecanamide (PubChem CID 91233832) has the molecular formula C18H26ClF2NO and a molecular weight of 345.86 g/mol. Its IUPAC name is 2-chloro-N-[(2,4-difluorophenyl)methyl]undecanamide.
| Compound Name | 2-chloro-N-[(2,4-difluorophenyl)methyl]undecanamide |
|---|---|
| PubChem CID | 91233832 |
| Molecular Formula | C18H26ClF2NO |
| Molecular Weight | 345.86 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | 2-chloro-N-[(2,4-difluorophenyl)methyl]undecanamide |
| SMILES | CCCCCCCCCC(Cl)C(=O)NCc1ccc(F)cc1F |
| InChI | InChI=1S/C18H26ClF2NO/c1-2-3-4-5-6-7-8-9-16(19)18(23)22-13-14-10-11-15(20)12-17(14)21/h10-12,16H,2-9,13H2,1H3,(H,22,23) |
| InChIKey | GBRCNRSNZQNLDK-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.86 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|