C16H15F4NOS2 — CID 134106708
2,2-dimethyl-3-(2,3,5,6-tetrafluorophenyl)sulfanyl-N-(thiophen-2-ylmethyl)propanamide (PubChem CID 134106708) has the molecular formula C16H15F4NOS2 and a molecular weight of 377.43 g/mol. Its IUPAC name is 2,2-dimethyl-3-(2,3,5,6-tetrafluorophenyl)sulfanyl-N-(thiophen-2-ylmethyl)propanamide.
| Compound Name | 2,2-dimethyl-3-(2,3,5,6-tetrafluorophenyl)sulfanyl-N-(thiophen-2-ylmethyl)propanamide |
|---|---|
| PubChem CID | 134106708 |
| Molecular Formula | C16H15F4NOS2 |
| Molecular Weight | 377.43 g/mol |
| Exact Mass | 377.05 |
| IUPAC Name | 2,2-dimethyl-3-(2,3,5,6-tetrafluorophenyl)sulfanyl-N-(thiophen-2-ylmethyl)propanamide |
| SMILES | CC(C)(CSc1c(F)c(F)cc(F)c1F)C(=O)NCc1cccs1 |
| InChI | InChI=1S/C16H15F4NOS2/c1-16(2,15(22)21-7-9-4-3-5-23-9)8-24-14-12(19)10(17)6-11(18)13(14)20/h3-6H,7-8H2,1-2H3,(H,21,22) |
| InChIKey | RCWLIPLORBXHAK-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.43 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|