C19H16F6O3 — CID 87292552
bis[2-(2,4,6-trifluorophenyl)propan-2-yl] carbonate (PubChem CID 87292552) has the molecular formula C19H16F6O3 and a molecular weight of 406.32 g/mol. Its IUPAC name is bis[2-(2,4,6-trifluorophenyl)propan-2-yl] carbonate.
| Compound Name | bis[2-(2,4,6-trifluorophenyl)propan-2-yl] carbonate |
|---|---|
| PubChem CID | 87292552 |
| Molecular Formula | C19H16F6O3 |
| Molecular Weight | 406.32 g/mol |
| Exact Mass | 406.10 |
| IUPAC Name | bis[2-(2,4,6-trifluorophenyl)propan-2-yl] carbonate |
| SMILES | CC(C)(OC(=O)OC(C)(C)c1c(F)cc(F)cc1F)c1c(F)cc(F)cc1F |
| InChI | InChI=1S/C19H16F6O3/c1-18(2,15-11(22)5-9(20)6-12(15)23)27-17(26)28-19(3,4)16-13(24)7-10(21)8-14(16)25/h5-8H,1-4H3 |
| InChIKey | PDIMTHWPOAMGLG-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.32 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |