C11H11F3O3 — CID 117049910
4-hydroxy-2-methyl-2-(2,4,6-trifluorophenyl)butanoic acid (PubChem CID 117049910) has the molecular formula C11H11F3O3 and a molecular weight of 248.20 g/mol. Its IUPAC name is 4-hydroxy-2-methyl-2-(2,4,6-trifluorophenyl)butanoic acid.
| Compound Name | 4-hydroxy-2-methyl-2-(2,4,6-trifluorophenyl)butanoic acid |
|---|---|
| PubChem CID | 117049910 |
| Molecular Formula | C11H11F3O3 |
| Molecular Weight | 248.20 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | 4-hydroxy-2-methyl-2-(2,4,6-trifluorophenyl)butanoic acid |
| SMILES | CC(CCO)(C(=O)O)c1c(F)cc(F)cc1F |
| InChI | InChI=1S/C11H11F3O3/c1-11(2-3-15,10(16)17)9-7(13)4-6(12)5-8(9)14/h4-5,15H,2-3H2,1H3,(H,16,17) |
| InChIKey | WBLBDPWHFNPMGA-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.20 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |