C15H21F2NO2 — CID 118337488
tert-butyl N-[1-(2-ethyl-3,5-difluorophenyl)ethyl]carbamate (PubChem CID 118337488) has the molecular formula C15H21F2NO2 and a molecular weight of 285.33 g/mol. Its IUPAC name is tert-butyl N-[1-(2-ethyl-3,5-difluorophenyl)ethyl]carbamate.
| Compound Name | tert-butyl N-[1-(2-ethyl-3,5-difluorophenyl)ethyl]carbamate |
|---|---|
| PubChem CID | 118337488 |
| Molecular Formula | C15H21F2NO2 |
| Molecular Weight | 285.33 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | tert-butyl N-[1-(2-ethyl-3,5-difluorophenyl)ethyl]carbamate |
| SMILES | CCc1c(F)cc(F)cc1C(C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H21F2NO2/c1-6-11-12(7-10(16)8-13(11)17)9(2)18-14(19)20-15(3,4)5/h7-9H,6H2,1-5H3,(H,18,19) |
| InChIKey | CSQBHNQUYDQXQB-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.33 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |