C20H23F2NO3 — CID 118337834
tert-butyl N-[1-(2,4-difluoro-6-phenylmethoxyphenyl)ethyl]carbamate (PubChem CID 118337834) has the molecular formula C20H23F2NO3 and a molecular weight of 363.40 g/mol. Its IUPAC name is tert-butyl N-[1-(2,4-difluoro-6-phenylmethoxyphenyl)ethyl]carbamate.
| Compound Name | tert-butyl N-[1-(2,4-difluoro-6-phenylmethoxyphenyl)ethyl]carbamate |
|---|---|
| PubChem CID | 118337834 |
| Molecular Formula | C20H23F2NO3 |
| Molecular Weight | 363.40 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | tert-butyl N-[1-(2,4-difluoro-6-phenylmethoxyphenyl)ethyl]carbamate |
| SMILES | CC(NC(=O)OC(C)(C)C)c1c(F)cc(F)cc1OCc1ccccc1 |
| InChI | InChI=1S/C20H23F2NO3/c1-13(23-19(24)26-20(2,3)4)18-16(22)10-15(21)11-17(18)25-12-14-8-6-5-7-9-14/h5-11,13H,12H2,1-4H3,(H,23,24) |
| InChIKey | DPEVXPDHSSLCOO-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.40 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |