C22H26FNO4 — CID 91566778
tert-butyl N-[(1S)-2-(3-fluoro-5-phenylmethoxyphenyl)-1-(oxiran-2-yl)ethyl]carbamate (PubChem CID 91566778) has the molecular formula C22H26FNO4 and a molecular weight of 387.45 g/mol. Its IUPAC name is tert-butyl N-[(1S)-2-(3-fluoro-5-phenylmethoxyphenyl)-1-(oxiran-2-yl)ethyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-2-(3-fluoro-5-phenylmethoxyphenyl)-1-(oxiran-2-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 91566778 |
| Molecular Formula | C22H26FNO4 |
| Molecular Weight | 387.45 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | tert-butyl N-[(1S)-2-(3-fluoro-5-phenylmethoxyphenyl)-1-(oxiran-2-yl)ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1cc(F)cc(OCc2ccccc2)c1)C1CO1 |
| InChI | InChI=1S/C22H26FNO4/c1-22(2,3)28-21(25)24-19(20-14-27-20)11-16-9-17(23)12-18(10-16)26-13-15-7-5-4-6-8-15/h4-10,12,19-20H,11,13-14H2,1-3H3,(H,24,25)/t19-,20?/m0/s1 |
| InChIKey | BHEIIELRSQAPFA-XJDOXCRVSA-N |
| XLogP | 4.24 |
| TPSA | 60.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.45 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|