C22H29NO4 — CID 163876641
tert-butyl N-[(1S)-1-[(2S)-oxiran-2-yl]-2-(4-phenylmethoxycyclohexa-2,4-dien-1-yl)ethyl]carbamate (PubChem CID 163876641) has the molecular formula C22H29NO4 and a molecular weight of 371.48 g/mol. Its IUPAC name is tert-butyl N-[(1S)-1-[(2S)-oxiran-2-yl]-2-(4-phenylmethoxycyclohexa-2,4-dien-1-yl)ethyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-1-[(2S)-oxiran-2-yl]-2-(4-phenylmethoxycyclohexa-2,4-dien-1-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 163876641 |
| Molecular Formula | C22H29NO4 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.21 |
| IUPAC Name | tert-butyl N-[(1S)-1-[(2S)-oxiran-2-yl]-2-(4-phenylmethoxycyclohexa-2,4-dien-1-yl)ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1C=CC(OCc2ccccc2)=CC1)[C@H]1CO1 |
| InChI | InChI=1S/C22H29NO4/c1-22(2,3)27-21(24)23-19(20-15-26-20)13-16-9-11-18(12-10-16)25-14-17-7-5-4-6-8-17/h4-9,11-12,16,19-20H,10,13-15H2,1-3H3,(H,23,24)/t16?,19-,20+/m0/s1 |
| InChIKey | PPLVICNLYJNWOC-KHMGXFTDSA-N |
| XLogP | 4.35 |
| TPSA | 60.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|