C13H16BrF2NO2 — CID 162452517
tert-butyl N-[(1R)-1-(3-bromo-2,5-difluorophenyl)ethyl]carbamate (PubChem CID 162452517) has the molecular formula C13H16BrF2NO2 and a molecular weight of 336.18 g/mol. Its IUPAC name is tert-butyl N-[(1R)-1-(3-bromo-2,5-difluorophenyl)ethyl]carbamate.
| Compound Name | tert-butyl N-[(1R)-1-(3-bromo-2,5-difluorophenyl)ethyl]carbamate |
|---|---|
| PubChem CID | 162452517 |
| Molecular Formula | C13H16BrF2NO2 |
| Molecular Weight | 336.18 g/mol |
| Exact Mass | 335.03 |
| IUPAC Name | tert-butyl N-[(1R)-1-(3-bromo-2,5-difluorophenyl)ethyl]carbamate |
| SMILES | C[C@@H](NC(=O)OC(C)(C)C)c1cc(F)cc(Br)c1F |
| InChI | InChI=1S/C13H16BrF2NO2/c1-7(17-12(18)19-13(2,3)4)9-5-8(15)6-10(14)11(9)16/h5-7H,1-4H3,(H,17,18)/t7-/m1/s1 |
| InChIKey | MJWAOTZHUWOHFY-SSDOTTSWSA-N |
| XLogP | 4.31 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.18 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|