C14H17BrF3NO2 — CID 151316382
tert-butyl N-[(1R)-1-[4-bromo-2-(difluoromethyl)-3-fluorophenyl]ethyl]carbamate (PubChem CID 151316382) has the molecular formula C14H17BrF3NO2 and a molecular weight of 368.19 g/mol. Its IUPAC name is tert-butyl N-[(1R)-1-[4-bromo-2-(difluoromethyl)-3-fluorophenyl]ethyl]carbamate.
| Compound Name | tert-butyl N-[(1R)-1-[4-bromo-2-(difluoromethyl)-3-fluorophenyl]ethyl]carbamate |
|---|---|
| PubChem CID | 151316382 |
| Molecular Formula | C14H17BrF3NO2 |
| Molecular Weight | 368.19 g/mol |
| Exact Mass | 367.04 |
| IUPAC Name | tert-butyl N-[(1R)-1-[4-bromo-2-(difluoromethyl)-3-fluorophenyl]ethyl]carbamate |
| SMILES | C[C@@H](NC(=O)OC(C)(C)C)c1ccc(Br)c(F)c1C(F)F |
| InChI | InChI=1S/C14H17BrF3NO2/c1-7(19-13(20)21-14(2,3)4)8-5-6-9(15)11(16)10(8)12(17)18/h5-7,12H,1-4H3,(H,19,20)/t7-/m1/s1 |
| InChIKey | OFMYBBMNCPOZHY-SSDOTTSWSA-N |
| XLogP | 5.11 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.19 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |