C17H15F3N2O4 — CID 90954419
[4-[hydroxy(methyl)carbamoyl]phenyl]methyl N-[(2,4,6-trifluorophenyl)methyl]carbamate (PubChem CID 90954419) has the molecular formula C17H15F3N2O4 and a molecular weight of 368.31 g/mol. Its IUPAC name is [4-[hydroxy(methyl)carbamoyl]phenyl]methyl N-[(2,4,6-trifluorophenyl)methyl]carbamate.
| Compound Name | [4-[hydroxy(methyl)carbamoyl]phenyl]methyl N-[(2,4,6-trifluorophenyl)methyl]carbamate |
|---|---|
| PubChem CID | 90954419 |
| Molecular Formula | C17H15F3N2O4 |
| Molecular Weight | 368.31 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | [4-[hydroxy(methyl)carbamoyl]phenyl]methyl N-[(2,4,6-trifluorophenyl)methyl]carbamate |
| SMILES | CN(O)C(=O)c1ccc(COC(=O)NCc2c(F)cc(F)cc2F)cc1 |
| InChI | InChI=1S/C17H15F3N2O4/c1-22(25)16(23)11-4-2-10(3-5-11)9-26-17(24)21-8-13-14(19)6-12(18)7-15(13)20/h2-7,25H,8-9H2,1H3,(H,21,24) |
| InChIKey | NATHVGFCAFLBON-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.31 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|