C11H11F2NO3 — CID 154453225
(3,5-difluorophenyl)methyl N-(2-oxopropyl)carbamate (PubChem CID 154453225) has the molecular formula C11H11F2NO3 and a molecular weight of 243.21 g/mol. Its IUPAC name is (3,5-difluorophenyl)methyl N-(2-oxopropyl)carbamate.
| Compound Name | (3,5-difluorophenyl)methyl N-(2-oxopropyl)carbamate |
|---|---|
| PubChem CID | 154453225 |
| Molecular Formula | C11H11F2NO3 |
| Molecular Weight | 243.21 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | (3,5-difluorophenyl)methyl N-(2-oxopropyl)carbamate |
| SMILES | CC(=O)CNC(=O)OCc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C11H11F2NO3/c1-7(15)5-14-11(16)17-6-8-2-9(12)4-10(13)3-8/h2-4H,5-6H2,1H3,(H,14,16) |
| InChIKey | JPUJCKIWTOQPQZ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.21 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |