C8H8F2N2O — CID 112708056
(3,5-difluorophenyl)methylurea (PubChem CID 112708056) has the molecular formula C8H8F2N2O and a molecular weight of 186.16 g/mol. Its IUPAC name is (3,5-difluorophenyl)methylurea.
| Compound Name | (3,5-difluorophenyl)methylurea |
|---|---|
| PubChem CID | 112708056 |
| Molecular Formula | C8H8F2N2O |
| Molecular Weight | 186.16 g/mol |
| Exact Mass | 186.06 |
| IUPAC Name | (3,5-difluorophenyl)methylurea |
| SMILES | NC(=O)NCc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C8H8F2N2O/c9-6-1-5(2-7(10)3-6)4-12-8(11)13/h1-3H,4H2,(H3,11,12,13) |
| InChIKey | ZNXYFKPTSMZEFH-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.16 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |