C14H19F3N2O — CID 174865579
2,2-dimethyl-3-(methylamino)-N-[(3,4,5-trifluorophenyl)methyl]butanamide (PubChem CID 174865579) has the molecular formula C14H19F3N2O and a molecular weight of 288.31 g/mol. Its IUPAC name is 2,2-dimethyl-3-(methylamino)-N-[(3,4,5-trifluorophenyl)methyl]butanamide.
| Compound Name | 2,2-dimethyl-3-(methylamino)-N-[(3,4,5-trifluorophenyl)methyl]butanamide |
|---|---|
| PubChem CID | 174865579 |
| Molecular Formula | C14H19F3N2O |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 2,2-dimethyl-3-(methylamino)-N-[(3,4,5-trifluorophenyl)methyl]butanamide |
| SMILES | CNC(C)C(C)(C)C(=O)NCc1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C14H19F3N2O/c1-8(18-4)14(2,3)13(20)19-7-9-5-10(15)12(17)11(16)6-9/h5-6,8,18H,7H2,1-4H3,(H,19,20) |
| InChIKey | HNMBTSXBPWUGIN-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|