C10H12F3NO — CID 94999639
(2S)-2-[(3,4,5-trifluorophenyl)methylamino]propan-1-ol (PubChem CID 94999639) has the molecular formula C10H12F3NO and a molecular weight of 219.21 g/mol. Its IUPAC name is (2S)-2-[(3,4,5-trifluorophenyl)methylamino]propan-1-ol.
| Compound Name | (2S)-2-[(3,4,5-trifluorophenyl)methylamino]propan-1-ol |
|---|---|
| PubChem CID | 94999639 |
| Molecular Formula | C10H12F3NO |
| Molecular Weight | 219.21 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | (2S)-2-[(3,4,5-trifluorophenyl)methylamino]propan-1-ol |
| SMILES | C[C@@H](CO)NCc1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C10H12F3NO/c1-6(5-15)14-4-7-2-8(11)10(13)9(12)3-7/h2-3,6,14-15H,4-5H2,1H3/t6-/m0/s1 |
| InChIKey | BWGWCPYEYFWPRX-LURJTMIESA-N |
| XLogP | 1.57 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.21 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|