C16H15ClF3N — CID 63050519
1-(3-chlorophenyl)-N-[(3,4,5-trifluorophenyl)methyl]propan-2-amine (PubChem CID 63050519) has the molecular formula C16H15ClF3N and a molecular weight of 313.75 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-N-[(3,4,5-trifluorophenyl)methyl]propan-2-amine.
| Compound Name | 1-(3-chlorophenyl)-N-[(3,4,5-trifluorophenyl)methyl]propan-2-amine |
|---|---|
| PubChem CID | 63050519 |
| Molecular Formula | C16H15ClF3N |
| Molecular Weight | 313.75 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | 1-(3-chlorophenyl)-N-[(3,4,5-trifluorophenyl)methyl]propan-2-amine |
| SMILES | CC(Cc1cccc(Cl)c1)NCc1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C16H15ClF3N/c1-10(5-11-3-2-4-13(17)6-11)21-9-12-7-14(18)16(20)15(19)8-12/h2-4,6-8,10,21H,5,9H2,1H3 |
| InChIKey | FDOMAJLLNGMHPU-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.75 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|