C15H20F3N — CID 81384303
(1R)-1-cyclohexyl-N-[(3,4,5-trifluorophenyl)methyl]ethanamine (PubChem CID 81384303) has the molecular formula C15H20F3N and a molecular weight of 271.33 g/mol. Its IUPAC name is (1R)-1-cyclohexyl-N-[(3,4,5-trifluorophenyl)methyl]ethanamine.
| Compound Name | (1R)-1-cyclohexyl-N-[(3,4,5-trifluorophenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 81384303 |
| Molecular Formula | C15H20F3N |
| Molecular Weight | 271.33 g/mol |
| Exact Mass | 271.15 |
| IUPAC Name | (1R)-1-cyclohexyl-N-[(3,4,5-trifluorophenyl)methyl]ethanamine |
| SMILES | C[C@@H](NCc1cc(F)c(F)c(F)c1)C1CCCCC1 |
| InChI | InChI=1S/C15H20F3N/c1-10(12-5-3-2-4-6-12)19-9-11-7-13(16)15(18)14(17)8-11/h7-8,10,12,19H,2-6,9H2,1H3/t10-/m1/s1 |
| InChIKey | CDPZGODQLIAVRK-SNVBAGLBSA-N |
| XLogP | 4.16 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.33 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|