C15H21F2N — CID 105403256
(1S)-1-cyclohexyl-N-[(3,5-difluorophenyl)methyl]ethanamine (PubChem CID 105403256) has the molecular formula C15H21F2N and a molecular weight of 253.34 g/mol. Its IUPAC name is (1S)-1-cyclohexyl-N-[(3,5-difluorophenyl)methyl]ethanamine.
| Compound Name | (1S)-1-cyclohexyl-N-[(3,5-difluorophenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 105403256 |
| Molecular Formula | C15H21F2N |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.16 |
| IUPAC Name | (1S)-1-cyclohexyl-N-[(3,5-difluorophenyl)methyl]ethanamine |
| SMILES | C[C@H](NCc1cc(F)cc(F)c1)C1CCCCC1 |
| InChI | InChI=1S/C15H21F2N/c1-11(13-5-3-2-4-6-13)18-10-12-7-14(16)9-15(17)8-12/h7-9,11,13,18H,2-6,10H2,1H3/t11-/m0/s1 |
| InChIKey | DXTCVMLQHLRZIA-NSHDSACASA-N |
| XLogP | 4.02 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |