C16H22FNO2 — CID 106700240
4-[[[(1R)-1-cyclohexylethyl]amino]methyl]-2-fluorobenzoic acid (PubChem CID 106700240) has the molecular formula C16H22FNO2 and a molecular weight of 279.35 g/mol. Its IUPAC name is 4-[[[(1R)-1-cyclohexylethyl]amino]methyl]-2-fluorobenzoic acid.
| Compound Name | 4-[[[(1R)-1-cyclohexylethyl]amino]methyl]-2-fluorobenzoic acid |
|---|---|
| PubChem CID | 106700240 |
| Molecular Formula | C16H22FNO2 |
| Molecular Weight | 279.35 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | 4-[[[(1R)-1-cyclohexylethyl]amino]methyl]-2-fluorobenzoic acid |
| SMILES | C[C@@H](NCc1ccc(C(=O)O)c(F)c1)C1CCCCC1 |
| InChI | InChI=1S/C16H22FNO2/c1-11(13-5-3-2-4-6-13)18-10-12-7-8-14(16(19)20)15(17)9-12/h7-9,11,13,18H,2-6,10H2,1H3,(H,19,20)/t11-/m1/s1 |
| InChIKey | DYBWBUKCZJJNLE-LLVKDONJSA-N |
| XLogP | 3.58 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.35 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |