C13H17F3N2O — CID 63050518
N-propyl-2-[(3,4,5-trifluorophenyl)methylamino]propanamide (PubChem CID 63050518) has the molecular formula C13H17F3N2O and a molecular weight of 274.29 g/mol. Its IUPAC name is N-propyl-2-[(3,4,5-trifluorophenyl)methylamino]propanamide.
| Compound Name | N-propyl-2-[(3,4,5-trifluorophenyl)methylamino]propanamide |
|---|---|
| PubChem CID | 63050518 |
| Molecular Formula | C13H17F3N2O |
| Molecular Weight | 274.29 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | N-propyl-2-[(3,4,5-trifluorophenyl)methylamino]propanamide |
| SMILES | CCCNC(=O)C(C)NCc1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C13H17F3N2O/c1-3-4-17-13(19)8(2)18-7-9-5-10(14)12(16)11(15)6-9/h5-6,8,18H,3-4,7H2,1-2H3,(H,17,19) |
| InChIKey | SCCAKXWADMARCW-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.29 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|