C15H15F3N2O2 — CID 119129013
N-(furan-2-ylmethyl)-2-[(3,4,5-trifluorophenyl)methylamino]propanamide (PubChem CID 119129013) has the molecular formula C15H15F3N2O2 and a molecular weight of 312.29 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-2-[(3,4,5-trifluorophenyl)methylamino]propanamide.
| Compound Name | N-(furan-2-ylmethyl)-2-[(3,4,5-trifluorophenyl)methylamino]propanamide |
|---|---|
| PubChem CID | 119129013 |
| Molecular Formula | C15H15F3N2O2 |
| Molecular Weight | 312.29 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | N-(furan-2-ylmethyl)-2-[(3,4,5-trifluorophenyl)methylamino]propanamide |
| SMILES | CC(NCc1cc(F)c(F)c(F)c1)C(=O)NCc1ccco1 |
| InChI | InChI=1S/C15H15F3N2O2/c1-9(15(21)20-8-11-3-2-4-22-11)19-7-10-5-12(16)14(18)13(17)6-10/h2-6,9,19H,7-8H2,1H3,(H,20,21) |
| InChIKey | GCUGETKRKDUAPF-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.29 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|