C15H30N2O3 — CID 134334637
N-[5-[(2-methoxyacetyl)amino]pentyl]-2,2,3-trimethylbutanamide (PubChem CID 134334637) has the molecular formula C15H30N2O3 and a molecular weight of 286.42 g/mol. Its IUPAC name is N-[5-[(2-methoxyacetyl)amino]pentyl]-2,2,3-trimethylbutanamide.
| Compound Name | N-[5-[(2-methoxyacetyl)amino]pentyl]-2,2,3-trimethylbutanamide |
|---|---|
| PubChem CID | 134334637 |
| Molecular Formula | C15H30N2O3 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.23 |
| IUPAC Name | N-[5-[(2-methoxyacetyl)amino]pentyl]-2,2,3-trimethylbutanamide |
| SMILES | COCC(=O)NCCCCCNC(=O)C(C)(C)C(C)C |
| InChI | InChI=1S/C15H30N2O3/c1-12(2)15(3,4)14(19)17-10-8-6-7-9-16-13(18)11-20-5/h12H,6-11H2,1-5H3,(H,16,18)(H,17,19) |
| InChIKey | JHTRZZOCWCGOAB-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|