C14H25NO4 — CID 167591874
N-(6,10-dioxoundecyl)-2-methoxyacetamide (PubChem CID 167591874) has the molecular formula C14H25NO4 and a molecular weight of 271.36 g/mol. Its IUPAC name is N-(6,10-dioxoundecyl)-2-methoxyacetamide.
| Compound Name | N-(6,10-dioxoundecyl)-2-methoxyacetamide |
|---|---|
| PubChem CID | 167591874 |
| Molecular Formula | C14H25NO4 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.18 |
| IUPAC Name | N-(6,10-dioxoundecyl)-2-methoxyacetamide |
| SMILES | COCC(=O)NCCCCCC(=O)CCCC(C)=O |
| InChI | InChI=1S/C14H25NO4/c1-12(16)7-6-9-13(17)8-4-3-5-10-15-14(18)11-19-2/h3-11H2,1-2H3,(H,15,18) |
| InChIKey | KWDHUNKTSINOCD-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|