C18H35NO2 — CID 178052296
3,3,5,5-tetramethyl-N-(6-oxooctyl)hexanamide (PubChem CID 178052296) has the molecular formula C18H35NO2 and a molecular weight of 297.48 g/mol. Its IUPAC name is 3,3,5,5-tetramethyl-N-(6-oxooctyl)hexanamide.
| Compound Name | 3,3,5,5-tetramethyl-N-(6-oxooctyl)hexanamide |
|---|---|
| PubChem CID | 178052296 |
| Molecular Formula | C18H35NO2 |
| Molecular Weight | 297.48 g/mol |
| Exact Mass | 297.27 |
| IUPAC Name | 3,3,5,5-tetramethyl-N-(6-oxooctyl)hexanamide |
| SMILES | CCC(=O)CCCCCNC(=O)CC(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C18H35NO2/c1-7-15(20)11-9-8-10-12-19-16(21)13-18(5,6)14-17(2,3)4/h7-14H2,1-6H3,(H,19,21) |
| InChIKey | KUKDCDQPWQNNDU-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.48 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|