C16H31NO3 — CID 170945583
2,4,4-trimethylpentan-2-yl N-(5-oxoheptyl)carbamate (PubChem CID 170945583) has the molecular formula C16H31NO3 and a molecular weight of 285.43 g/mol. Its IUPAC name is 2,4,4-trimethylpentan-2-yl N-(5-oxoheptyl)carbamate.
| Compound Name | 2,4,4-trimethylpentan-2-yl N-(5-oxoheptyl)carbamate |
|---|---|
| PubChem CID | 170945583 |
| Molecular Formula | C16H31NO3 |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.23 |
| IUPAC Name | 2,4,4-trimethylpentan-2-yl N-(5-oxoheptyl)carbamate |
| SMILES | CCC(=O)CCCCNC(=O)OC(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C16H31NO3/c1-7-13(18)10-8-9-11-17-14(19)20-16(5,6)12-15(2,3)4/h7-12H2,1-6H3,(H,17,19) |
| InChIKey | MSFKAEAEUGJKKM-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|