C14H26NO4- — CID 155764709
8-(2-methylbutan-2-yloxycarbonylamino)octanoate (PubChem CID 155764709) has the molecular formula C14H26NO4- and a molecular weight of 272.36 g/mol. Its IUPAC name is 8-(2-methylbutan-2-yloxycarbonylamino)octanoate.
| Compound Name | 8-(2-methylbutan-2-yloxycarbonylamino)octanoate |
|---|---|
| PubChem CID | 155764709 |
| Molecular Formula | C14H26NO4- |
| Molecular Weight | 272.36 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | 8-(2-methylbutan-2-yloxycarbonylamino)octanoate |
| SMILES | CCC(C)(C)OC(=O)NCCCCCCCC(=O)[O-] |
| InChI | InChI=1S/C14H27NO4/c1-4-14(2,3)19-13(18)15-11-9-7-5-6-8-10-12(16)17/h4-11H2,1-3H3,(H,15,18)(H,16,17)/p-1 |
| InChIKey | WBEMVBMFYAZFRF-UHFFFAOYSA-M |
| XLogP | 1.99 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.36 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|