About potassium;3,3-dimethylhexanoyl chloride;hydroxide
potassium;3,3-dimethylhexanoyl chloride;hydroxide (PubChem CID 143631773) has the molecular formula C8H16ClKO2
and a molecular weight of 218.76 g/mol. Its IUPAC name is potassium;3,3-dimethylhexanoyl chloride;hydroxide.
Molecular Properties
| Compound Name | potassium;3,3-dimethylhexanoyl chloride;hydroxide |
| PubChem CID | 143631773 |
| Molecular Formula | C8H16ClKO2 |
| Molecular Weight | 218.76 g/mol |
| Exact Mass | 218.05 |
| IUPAC Name | potassium;3,3-dimethylhexanoyl chloride;hydroxide |
| SMILES | CCCC(C)(C)CC(=O)Cl.[K+].[OH-] |
| InChI | InChI=1S/C8H15ClO.K.H2O/c1-4-5-8(2,3)6-7(9)10;;/h4-6H2,1-3H3;;1H2/q;+1;/p-1 |
| InChIKey | NCWIWBRQPJENET-UHFFFAOYSA-M |
| XLogP | -0.20 |
| TPSA | 47.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.76 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze potassium;3,3-dimethylhexanoyl chloride;hydroxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;3,3-dimethylhexanoyl chloride;hydroxide?
The IUPAC name of potassium;3,3-dimethylhexanoyl chloride;hydroxide (CID 143631773) is potassium;3,3-dimethylhexanoyl chloride;hydroxide.
What is the SMILES notation for potassium;3,3-dimethylhexanoyl chloride;hydroxide?
The canonical SMILES for potassium;3,3-dimethylhexanoyl chloride;hydroxide is CCCC(C)(C)CC(=O)Cl.[K+].[OH-].
What is the InChIKey of potassium;3,3-dimethylhexanoyl chloride;hydroxide?
The InChIKey is NCWIWBRQPJENET-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H15ClO.K.H2O/c1-4-5-8(2,3)6-7(9)10;;/h4-6H2,1-3H3;;1H2/q;+1;/p-1.
What are the key properties of potassium;3,3-dimethylhexanoyl chloride;hydroxide?
potassium;3,3-dimethylhexanoyl chloride;hydroxide has a molecular weight of 218.76 g/mol, XLogP of -0.20, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;3,3-dimethylhexanoyl chloride;hydroxide is sourced from PubChem (CID 143631773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).