C19H37NO2S — CID 146647546
S-[4-(3,3-dimethylhexanoylamino)butyl] 4,4-dimethylpentanethioate (PubChem CID 146647546) has the molecular formula C19H37NO2S and a molecular weight of 343.58 g/mol. Its IUPAC name is S-[4-(3,3-dimethylhexanoylamino)butyl] 4,4-dimethylpentanethioate.
| Compound Name | S-[4-(3,3-dimethylhexanoylamino)butyl] 4,4-dimethylpentanethioate |
|---|---|
| PubChem CID | 146647546 |
| Molecular Formula | C19H37NO2S |
| Molecular Weight | 343.58 g/mol |
| Exact Mass | 343.25 |
| IUPAC Name | S-[4-(3,3-dimethylhexanoylamino)butyl] 4,4-dimethylpentanethioate |
| SMILES | CCCC(C)(C)CC(=O)NCCCCSC(=O)CCC(C)(C)C |
| InChI | InChI=1S/C19H37NO2S/c1-7-11-19(5,6)15-16(21)20-13-8-9-14-23-17(22)10-12-18(2,3)4/h7-15H2,1-6H3,(H,20,21) |
| InChIKey | ZINCNCFJVBNQCP-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.58 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|