C20H34N2O3 — CID 67087089
tert-butyl N-[(5S)-6-amino-3,3-dimethyl-5-phenylmethoxyhexyl]carbamate (PubChem CID 67087089) has the molecular formula C20H34N2O3 and a molecular weight of 350.50 g/mol. Its IUPAC name is tert-butyl N-[(5S)-6-amino-3,3-dimethyl-5-phenylmethoxyhexyl]carbamate.
| Compound Name | tert-butyl N-[(5S)-6-amino-3,3-dimethyl-5-phenylmethoxyhexyl]carbamate |
|---|---|
| PubChem CID | 67087089 |
| Molecular Formula | C20H34N2O3 |
| Molecular Weight | 350.50 g/mol |
| Exact Mass | 350.26 |
| IUPAC Name | tert-butyl N-[(5S)-6-amino-3,3-dimethyl-5-phenylmethoxyhexyl]carbamate |
| SMILES | CC(C)(CCNC(=O)OC(C)(C)C)C[C@@H](CN)OCc1ccccc1 |
| InChI | InChI=1S/C20H34N2O3/c1-19(2,3)25-18(23)22-12-11-20(4,5)13-17(14-21)24-15-16-9-7-6-8-10-16/h6-10,17H,11-15,21H2,1-5H3,(H,22,23)/t17-/m0/s1 |
| InChIKey | TZIBOOLCEYZWOI-KRWDZBQOSA-N |
| XLogP | 3.86 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.50 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |