C23H30O7 — CID 158421416
1-O-[2-(2,2-dimethylbutanoyloxy)ethyl] 4-O-(3-oxo-1-phenylcyclopentyl) butanedioate (PubChem CID 158421416) has the molecular formula C23H30O7 and a molecular weight of 418.49 g/mol. Its IUPAC name is 1-O-[2-(2,2-dimethylbutanoyloxy)ethyl] 4-O-(3-oxo-1-phenylcyclopentyl) butanedioate.
| Compound Name | 1-O-[2-(2,2-dimethylbutanoyloxy)ethyl] 4-O-(3-oxo-1-phenylcyclopentyl) butanedioate |
|---|---|
| PubChem CID | 158421416 |
| Molecular Formula | C23H30O7 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | 1-O-[2-(2,2-dimethylbutanoyloxy)ethyl] 4-O-(3-oxo-1-phenylcyclopentyl) butanedioate |
| SMILES | CCC(C)(C)C(=O)OCCOC(=O)CCC(=O)OC1(c2ccccc2)CCC(=O)C1 |
| InChI | InChI=1S/C23H30O7/c1-4-22(2,3)21(27)29-15-14-28-19(25)10-11-20(26)30-23(13-12-18(24)16-23)17-8-6-5-7-9-17/h5-9H,4,10-16H2,1-3H3 |
| InChIKey | PXQBAUNESKGQJQ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|