C16H29IO3 — CID 118422663
cyclohexyl 4-iodooxy-2,4-dimethyl-2-propan-2-ylpentanoate (PubChem CID 118422663) has the molecular formula C16H29IO3 and a molecular weight of 396.31 g/mol. Its IUPAC name is cyclohexyl 4-iodooxy-2,4-dimethyl-2-propan-2-ylpentanoate.
| Compound Name | cyclohexyl 4-iodooxy-2,4-dimethyl-2-propan-2-ylpentanoate |
|---|---|
| PubChem CID | 118422663 |
| Molecular Formula | C16H29IO3 |
| Molecular Weight | 396.31 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | cyclohexyl 4-iodooxy-2,4-dimethyl-2-propan-2-ylpentanoate |
| SMILES | CC(C)C(C)(CC(C)(C)OI)C(=O)OC1CCCCC1 |
| InChI | InChI=1S/C16H29IO3/c1-12(2)16(5,11-15(3,4)20-17)14(18)19-13-9-7-6-8-10-13/h12-13H,6-11H2,1-5H3 |
| InChIKey | OFIDPJVERRCPGA-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.31 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|