About 1-cyclopentyloxybutyl 2-methyl-2-propan-2-ylpentanoate
1-cyclopentyloxybutyl 2-methyl-2-propan-2-ylpentanoate (PubChem CID 144561227) has the molecular formula C18H34O3
and a molecular weight of 298.47 g/mol. Its IUPAC name is 1-cyclopentyloxybutyl 2-methyl-2-propan-2-ylpentanoate.
Molecular Properties
| Compound Name | 1-cyclopentyloxybutyl 2-methyl-2-propan-2-ylpentanoate |
| PubChem CID | 144561227 |
| Molecular Formula | C18H34O3 |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.25 |
| IUPAC Name | 1-cyclopentyloxybutyl 2-methyl-2-propan-2-ylpentanoate |
| SMILES | CCCC(OC(=O)C(C)(CCC)C(C)C)OC1CCCC1 |
| InChI | InChI=1S/C18H34O3/c1-6-10-16(20-15-11-8-9-12-15)21-17(19)18(5,13-7-2)14(3)4/h14-16H,6-13H2,1-5H3 |
| InChIKey | CFDKVBVRBYNKBY-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclopentyloxybutyl 2-methyl-2-propan-2-ylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopentyloxybutyl 2-methyl-2-propan-2-ylpentanoate?
The IUPAC name of 1-cyclopentyloxybutyl 2-methyl-2-propan-2-ylpentanoate (CID 144561227) is 1-cyclopentyloxybutyl 2-methyl-2-propan-2-ylpentanoate.
What is the SMILES notation for 1-cyclopentyloxybutyl 2-methyl-2-propan-2-ylpentanoate?
The canonical SMILES for 1-cyclopentyloxybutyl 2-methyl-2-propan-2-ylpentanoate is CCCC(OC(=O)C(C)(CCC)C(C)C)OC1CCCC1.
What is the InChIKey of 1-cyclopentyloxybutyl 2-methyl-2-propan-2-ylpentanoate?
The InChIKey is CFDKVBVRBYNKBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H34O3/c1-6-10-16(20-15-11-8-9-12-15)21-17(19)18(5,13-7-2)14(3)4/h14-16H,6-13H2,1-5H3.
What are the key properties of 1-cyclopentyloxybutyl 2-methyl-2-propan-2-ylpentanoate?
1-cyclopentyloxybutyl 2-methyl-2-propan-2-ylpentanoate has a molecular weight of 298.47 g/mol, XLogP of 5.08, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopentyloxybutyl 2-methyl-2-propan-2-ylpentanoate is sourced from PubChem (CID 144561227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).