C24H56O5S3Si — CID 123320535
3-[bis[(trimethyl-λ4-sulfanyl)oxy]-trimethylsilyloxy-λ4-sulfanyl]propyl 2-tert-butyl-2,4,4-trimethylpentanoate (PubChem CID 123320535) has the molecular formula C24H56O5S3Si and a molecular weight of 548.99 g/mol. Its IUPAC name is 3-[bis[(trimethyl-λ4-sulfanyl)oxy]-trimethylsilyloxy-λ4-sulfanyl]propyl 2-tert-butyl-2,4,4-trimethylpentanoate.
| Compound Name | 3-[bis[(trimethyl-λ4-sulfanyl)oxy]-trimethylsilyloxy-λ4-sulfanyl]propyl 2-tert-butyl-2,4,4-trimethylpentanoate |
|---|---|
| PubChem CID | 123320535 |
| Molecular Formula | C24H56O5S3Si |
| Molecular Weight | 548.99 g/mol |
| Exact Mass | 548.31 |
| IUPAC Name | 3-[bis[(trimethyl-λ4-sulfanyl)oxy]-trimethylsilyloxy-λ4-sulfanyl]propyl 2-tert-butyl-2,4,4-trimethylpentanoate |
| SMILES | CC(C)(C)CC(C)(C(=O)OCCCS(O[Si](C)(C)C)(OS(C)(C)C)OS(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C24H56O5S3Si/c1-22(2,3)20-24(7,23(4,5)6)21(25)26-18-17-19-32(27-30(8,9)10,28-31(11,12)13)29-33(14,15)16/h17-20H2,1-16H3 |
| InChIKey | JEQKNDQFXSNJOH-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.99 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|