C16H28N4O6S2 — CID 21397037
2-[[2-methyl-2-[[2-methyl-1-oxo-1-[2-(2-sulfanylacetyl)oxyethylamino]propan-2-yl]diazenyl]propanoyl]amino]ethyl 2-sulfanylacetate (PubChem CID 21397037) has the molecular formula C16H28N4O6S2 and a molecular weight of 436.56 g/mol. Its IUPAC name is 2-[[2-methyl-2-[[2-methyl-1-oxo-1-[2-(2-sulfanylacetyl)oxyethylamino]propan-2-yl]diazenyl]propanoyl]amino]ethyl 2-sulfanylacetate.
| Compound Name | 2-[[2-methyl-2-[[2-methyl-1-oxo-1-[2-(2-sulfanylacetyl)oxyethylamino]propan-2-yl]diazenyl]propanoyl]amino]ethyl 2-sulfanylacetate |
|---|---|
| PubChem CID | 21397037 |
| Molecular Formula | C16H28N4O6S2 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | 2-[[2-methyl-2-[[2-methyl-1-oxo-1-[2-(2-sulfanylacetyl)oxyethylamino]propan-2-yl]diazenyl]propanoyl]amino]ethyl 2-sulfanylacetate |
| SMILES | CC(C)(/N=N/C(C)(C)C(=O)NCCOC(=O)CS)C(=O)NCCOC(=O)CS |
| InChI | InChI=1S/C16H28N4O6S2/c1-15(2,13(23)17-5-7-25-11(21)9-27)19-20-16(3,4)14(24)18-6-8-26-12(22)10-28/h27-28H,5-10H2,1-4H3,(H,17,23)(H,18,24)/b20-19+ |
| InChIKey | LFGNAMFPMUNYBY-FMQUCBEESA-N |
| XLogP | 0.17 |
| TPSA | 135.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|