C25H47N3O12P2 — CID 58264990
[6-[5-methyl-5-[[2-methyl-1-oxo-1-[2-(6-phosphonohexanoyloxy)ethylamino]propan-2-yl]diazenyl]-4-oxohexoxy]-6-oxohexyl]phosphonic acid (PubChem CID 58264990) has the molecular formula C25H47N3O12P2 and a molecular weight of 643.61 g/mol. Its IUPAC name is [6-[5-methyl-5-[[2-methyl-1-oxo-1-[2-(6-phosphonohexanoyloxy)ethylamino]propan-2-yl]diazenyl]-4-oxohexoxy]-6-oxohexyl]phosphonic acid.
| Compound Name | [6-[5-methyl-5-[[2-methyl-1-oxo-1-[2-(6-phosphonohexanoyloxy)ethylamino]propan-2-yl]diazenyl]-4-oxohexoxy]-6-oxohexyl]phosphonic acid |
|---|---|
| PubChem CID | 58264990 |
| Molecular Formula | C25H47N3O12P2 |
| Molecular Weight | 643.61 g/mol |
| Exact Mass | 643.26 |
| IUPAC Name | [6-[5-methyl-5-[[2-methyl-1-oxo-1-[2-(6-phosphonohexanoyloxy)ethylamino]propan-2-yl]diazenyl]-4-oxohexoxy]-6-oxohexyl]phosphonic acid |
| SMILES | CC(C)(/N=N/C(C)(C)C(=O)NCCOC(=O)CCCCCP(=O)(O)O)C(=O)CCCOC(=O)CCCCCP(=O)(O)O |
| InChI | InChI=1S/C25H47N3O12P2/c1-24(2,20(29)12-11-16-39-21(30)13-7-5-9-18-41(33,34)35)27-28-25(3,4)23(32)26-15-17-40-22(31)14-8-6-10-19-42(36,37)38/h5-19H2,1-4H3,(H,26,32)(H2,33,34,35)(H2,36,37,38)/b28-27+ |
| InChIKey | WGDDBKWLZMGAMZ-BYYHNAKLSA-N |
| XLogP | 3.02 |
| TPSA | 238.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.61 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|