C13H24N4O4S — CID 88817841
3-[[2-[(1-amino-2-methyl-1-oxopropan-2-yl)diazenyl]-2-methylpropanoyl]amino]propyl 2-sulfanylacetate (PubChem CID 88817841) has the molecular formula C13H24N4O4S and a molecular weight of 332.43 g/mol. Its IUPAC name is 3-[[2-[(1-amino-2-methyl-1-oxopropan-2-yl)diazenyl]-2-methylpropanoyl]amino]propyl 2-sulfanylacetate.
| Compound Name | 3-[[2-[(1-amino-2-methyl-1-oxopropan-2-yl)diazenyl]-2-methylpropanoyl]amino]propyl 2-sulfanylacetate |
|---|---|
| PubChem CID | 88817841 |
| Molecular Formula | C13H24N4O4S |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | 3-[[2-[(1-amino-2-methyl-1-oxopropan-2-yl)diazenyl]-2-methylpropanoyl]amino]propyl 2-sulfanylacetate |
| SMILES | CC(C)(/N=N/C(C)(C)C(=O)NCCCOC(=O)CS)C(N)=O |
| InChI | InChI=1S/C13H24N4O4S/c1-12(2,10(14)19)16-17-13(3,4)11(20)15-6-5-7-21-9(18)8-22/h22H,5-8H2,1-4H3,(H2,14,19)(H,15,20)/b17-16+ |
| InChIKey | YAIFKZVEEOJAKB-WUKNDPDISA-N |
| XLogP | 0.46 |
| TPSA | 123.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|