C17H34N5O3+ — CID 91802977
[1-(butylamino)-2-methyl-1-oxopropan-2-yl]-[1-(butylamino)-2-methyl-1-oxopropan-2-yl]imino-carbamoylazanium (PubChem CID 91802977) has the molecular formula C17H34N5O3+ and a molecular weight of 356.49 g/mol. Its IUPAC name is [1-(butylamino)-2-methyl-1-oxopropan-2-yl]-[1-(butylamino)-2-methyl-1-oxopropan-2-yl]imino-carbamoylazanium.
| Compound Name | [1-(butylamino)-2-methyl-1-oxopropan-2-yl]-[1-(butylamino)-2-methyl-1-oxopropan-2-yl]imino-carbamoylazanium |
|---|---|
| PubChem CID | 91802977 |
| Molecular Formula | C17H34N5O3+ |
| Molecular Weight | 356.49 g/mol |
| Exact Mass | 356.27 |
| IUPAC Name | [1-(butylamino)-2-methyl-1-oxopropan-2-yl]-[1-(butylamino)-2-methyl-1-oxopropan-2-yl]imino-carbamoylazanium |
| SMILES | CCCCNC(=O)C(C)(C)/N=[N+](\C(N)=O)C(C)(C)C(=O)NCCCC |
| InChI | InChI=1S/C17H33N5O3/c1-7-9-11-19-13(23)16(3,4)21-22(15(18)25)17(5,6)14(24)20-12-10-8-2/h7-12H2,1-6H3,(H3-,18,19,20,23,24,25)/p+1/b22-21+ |
| InChIKey | AGFJVJHYBBXXMG-QURGRASLSA-O |
| XLogP | 1.92 |
| TPSA | 116.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.49 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|