C21H40N8O3 — CID 87746136
N-butyl-2-[[1-(butylamino)-2-methyl-1-oxopropan-2-yl]diazenyl]-2-methylpropanamide;2-cyanopropan-2-yliminourea (PubChem CID 87746136) has the molecular formula C21H40N8O3 and a molecular weight of 452.60 g/mol. Its IUPAC name is N-butyl-2-[[1-(butylamino)-2-methyl-1-oxopropan-2-yl]diazenyl]-2-methylpropanamide;2-cyanopropan-2-yliminourea.
| Compound Name | N-butyl-2-[[1-(butylamino)-2-methyl-1-oxopropan-2-yl]diazenyl]-2-methylpropanamide;2-cyanopropan-2-yliminourea |
|---|---|
| PubChem CID | 87746136 |
| Molecular Formula | C21H40N8O3 |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.32 |
| IUPAC Name | N-butyl-2-[[1-(butylamino)-2-methyl-1-oxopropan-2-yl]diazenyl]-2-methylpropanamide;2-cyanopropan-2-yliminourea |
| SMILES | CC(C)(C#N)/N=N/C(N)=O.CCCCNC(=O)C(C)(C)/N=N/C(C)(C)C(=O)NCCCC |
| InChI | InChI=1S/C16H32N4O2.C5H8N4O/c1-7-9-11-17-13(21)15(3,4)19-20-16(5,6)14(22)18-12-10-8-2;1-5(2,3-6)9-8-4(7)10/h7-12H2,1-6H3,(H,17,21)(H,18,22);1-2H3,(H2,7,10)/b20-19+;9-8+ |
| InChIKey | YRQDPJUAZYWRRA-HWIHELIDSA-N |
| XLogP | 3.65 |
| TPSA | 174.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|