C12H24N4O2S2 — CID 21397036
2-methyl-2-[[2-methyl-1-oxo-1-(2-sulfanylethylamino)propan-2-yl]diazenyl]-N-(2-sulfanylethyl)propanamide (PubChem CID 21397036) has the molecular formula C12H24N4O2S2 and a molecular weight of 320.48 g/mol. Its IUPAC name is 2-methyl-2-[[2-methyl-1-oxo-1-(2-sulfanylethylamino)propan-2-yl]diazenyl]-N-(2-sulfanylethyl)propanamide.
| Compound Name | 2-methyl-2-[[2-methyl-1-oxo-1-(2-sulfanylethylamino)propan-2-yl]diazenyl]-N-(2-sulfanylethyl)propanamide |
|---|---|
| PubChem CID | 21397036 |
| Molecular Formula | C12H24N4O2S2 |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 2-methyl-2-[[2-methyl-1-oxo-1-(2-sulfanylethylamino)propan-2-yl]diazenyl]-N-(2-sulfanylethyl)propanamide |
| SMILES | CC(C)(/N=N/C(C)(C)C(=O)NCCS)C(=O)NCCS |
| InChI | InChI=1S/C12H24N4O2S2/c1-11(2,9(17)13-5-7-19)15-16-12(3,4)10(18)14-6-8-20/h19-20H,5-8H2,1-4H3,(H,13,17)(H,14,18)/b16-15+ |
| InChIKey | DAOQQZFRSZSDDD-FOCLMDBBSA-N |
| XLogP | 1.09 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|