C12H25N2O7PS — CID 155145191
[3-hydroxy-2,2,3-trimethyl-4-oxo-4-[[3-oxo-3-(2-sulfanylethylamino)propyl]amino]butyl] dihydrogen phosphate (PubChem CID 155145191) has the molecular formula C12H25N2O7PS and a molecular weight of 372.38 g/mol. Its IUPAC name is [3-hydroxy-2,2,3-trimethyl-4-oxo-4-[[3-oxo-3-(2-sulfanylethylamino)propyl]amino]butyl] dihydrogen phosphate.
| Compound Name | [3-hydroxy-2,2,3-trimethyl-4-oxo-4-[[3-oxo-3-(2-sulfanylethylamino)propyl]amino]butyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 155145191 |
| Molecular Formula | C12H25N2O7PS |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | [3-hydroxy-2,2,3-trimethyl-4-oxo-4-[[3-oxo-3-(2-sulfanylethylamino)propyl]amino]butyl] dihydrogen phosphate |
| SMILES | CC(C)(COP(=O)(O)O)C(C)(O)C(=O)NCCC(=O)NCCS |
| InChI | InChI=1S/C12H25N2O7PS/c1-11(2,8-21-22(18,19)20)12(3,17)10(16)14-5-4-9(15)13-6-7-23/h17,23H,4-8H2,1-3H3,(H,13,15)(H,14,16)(H2,18,19,20) |
| InChIKey | UPMCEGOYHFIONW-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 145.19 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|