C19H38N3O8PS — CID 176730581
[(3R)-3-hydroxy-2,2-dimethyl-4-oxo-4-[[3-oxo-3-[2-[[(2S)-2-sulfanyloctanoyl]amino]ethylamino]propyl]amino]butyl] dihydrogen phosphate (PubChem CID 176730581) has the molecular formula C19H38N3O8PS and a molecular weight of 499.57 g/mol. Its IUPAC name is [(3R)-3-hydroxy-2,2-dimethyl-4-oxo-4-[[3-oxo-3-[2-[[(2S)-2-sulfanyloctanoyl]amino]ethylamino]propyl]amino]butyl] dihydrogen phosphate.
| Compound Name | [(3R)-3-hydroxy-2,2-dimethyl-4-oxo-4-[[3-oxo-3-[2-[[(2S)-2-sulfanyloctanoyl]amino]ethylamino]propyl]amino]butyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 176730581 |
| Molecular Formula | C19H38N3O8PS |
| Molecular Weight | 499.57 g/mol |
| Exact Mass | 499.21 |
| IUPAC Name | [(3R)-3-hydroxy-2,2-dimethyl-4-oxo-4-[[3-oxo-3-[2-[[(2S)-2-sulfanyloctanoyl]amino]ethylamino]propyl]amino]butyl] dihydrogen phosphate |
| SMILES | CCCCCC[C@H](S)C(=O)NCCNC(=O)CCNC(=O)[C@H](O)C(C)(C)COP(=O)(O)O |
| InChI | InChI=1S/C19H38N3O8PS/c1-4-5-6-7-8-14(32)17(25)22-12-11-20-15(23)9-10-21-18(26)16(24)19(2,3)13-30-31(27,28)29/h14,16,24,32H,4-13H2,1-3H3,(H,20,23)(H,21,26)(H,22,25)(H2,27,28,29)/t14-,16-/m0/s1 |
| InChIKey | NSQGPZZZKVERQR-HOCLYGCPSA-N |
| XLogP | 0.49 |
| TPSA | 174.29 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.57 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|